C17H28O4 — CID 139114403
(1R,1'S,2R,3R,4S,5'R,7R)-7-ethenyl-1-(hydroxymethyl)-5'-(2-hydroxypropan-2-yl)spiro[bicyclo[2.2.1]heptane-3,2'-cyclopentane]-1',2-diol (PubChem CID 139114403) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1R,1'S,2R,3R,4S,5'R,7R)-7-ethenyl-1-(hydroxymethyl)-5'-(2-hydroxypropan-2-yl)spiro[bicyclo[2.2.1]heptane-3,2'-cyclopentane]-1',2-diol.
| Compound Name | (1R,1'S,2R,3R,4S,5'R,7R)-7-ethenyl-1-(hydroxymethyl)-5'-(2-hydroxypropan-2-yl)spiro[bicyclo[2.2.1]heptane-3,2'-cyclopentane]-1',2-diol |
|---|---|
| PubChem CID | 139114403 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1R,1'S,2R,3R,4S,5'R,7R)-7-ethenyl-1-(hydroxymethyl)-5'-(2-hydroxypropan-2-yl)spiro[bicyclo[2.2.1]heptane-3,2'-cyclopentane]-1',2-diol |
| SMILES | C=C[C@@H]1[C@@H]2CC[C@@]1(CO)[C@@H](O)[C@]21CC[C@@H](C(C)(C)O)[C@@H]1O |
| InChI | InChI=1S/C17H28O4/c1-4-10-11-5-7-16(10,9-18)14(20)17(11)8-6-12(13(17)19)15(2,3)21/h4,10-14,18-21H,1,5-9H2,2-3H3/t10-,11+,12-,13+,14-,16+,17-/m1/s1 |
| InChIKey | ZUIFBDZKSSSRGJ-XHZXGTLWSA-N |
| XLogP | 1.08 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|