C24H41NO3Si — CID 101481945
(1S,1'S,2S,2'S,4R,7S)-7-ethenyl-2,2'-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]spiro[bicyclo[2.2.1]heptane-3,3'-cyclopentane]-1'-carbonitrile (PubChem CID 101481945) has the molecular formula C24H41NO3Si and a molecular weight of 419.68 g/mol. Its IUPAC name is (1S,1'S,2S,2'S,4R,7S)-7-ethenyl-2,2'-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]spiro[bicyclo[2.2.1]heptane-3,3'-cyclopentane]-1'-carbonitrile.
| Compound Name | (1S,1'S,2S,2'S,4R,7S)-7-ethenyl-2,2'-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]spiro[bicyclo[2.2.1]heptane-3,3'-cyclopentane]-1'-carbonitrile |
|---|---|
| PubChem CID | 101481945 |
| Molecular Formula | C24H41NO3Si |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | (1S,1'S,2S,2'S,4R,7S)-7-ethenyl-2,2'-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]spiro[bicyclo[2.2.1]heptane-3,3'-cyclopentane]-1'-carbonitrile |
| SMILES | C=C[C@H]1[C@H]2CC[C@]1(CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](O)C21CC[C@@H](C#N)[C@@H]1O |
| InChI | InChI=1S/C24H41NO3Si/c1-8-19-20-10-11-23(19,14-28-29(15(2)3,16(4)5)17(6)7)22(27)24(20)12-9-18(13-25)21(24)26/h8,15-22,26-27H,1,9-12,14H2,2-7H3/t18-,19-,20+,21-,22-,23+,24?/m0/s1 |
| InChIKey | KJBSJEONOBYEOZ-UIRLPPNRSA-N |
| XLogP | 5.03 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|