C17H26BNO4 — CID 139116593
1-[(E)-prop-1-enyl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 139116593) has the molecular formula C17H26BNO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is 1-[(E)-prop-1-enyl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 1-[(E)-prop-1-enyl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 139116593 |
| Molecular Formula | C17H26BNO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1-[(E)-prop-1-enyl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | C/C=C/[B-]12OC(=O)C[N+]1([C@@H]1C[C@@H]3C[C@H]([C@H]1C)C3(C)C)CC(=O)O2 |
| InChI | InChI=1S/C17H26BNO4/c1-5-6-18-19(9-15(20)22-18,10-16(21)23-18)14-8-12-7-13(11(14)2)17(12,3)4/h5-6,11-14H,7-10H2,1-4H3/b6-5+/t11-,12+,13-,14-,18?,19?/m1/s1 |
| InChIKey | AHBWBJLVCHLCSD-HDZWERQRSA-N |
| XLogP | 2.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|