C20H23F3O6 — CID 139116729
[(2S,3S,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139116729) has the molecular formula C20H23F3O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is [(2S,3S,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,3S,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139116729 |
| Molecular Formula | C20H23F3O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [(2S,3S,3aR,6aR)-3-tert-butyl-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H]1O[C@@H]2OC(=O)C[C@@H]2[C@H]1C(C)(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3O6/c1-18(2,3)14-12-10-13(24)27-15(12)28-16(14)29-17(25)19(26-4,20(21,22)23)11-8-6-5-7-9-11/h5-9,12,14-16H,10H2,1-4H3/t12-,14-,15+,16+,19+/m1/s1 |
| InChIKey | RWLNLCGHXMKPFB-DPNDMPAOSA-N |
| XLogP | 3.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |