C24H25F3O5 — CID 155931778
[(8R,11S)-4-methyl-13,15-dioxatetracyclo[9.4.0.01,4.05,9]pentadeca-2,5(9)-dien-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 155931778) has the molecular formula C24H25F3O5 and a molecular weight of 450.45 g/mol. Its IUPAC name is [(8R,11S)-4-methyl-13,15-dioxatetracyclo[9.4.0.01,4.05,9]pentadeca-2,5(9)-dien-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(8R,11S)-4-methyl-13,15-dioxatetracyclo[9.4.0.01,4.05,9]pentadeca-2,5(9)-dien-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 155931778 |
| Molecular Formula | C24H25F3O5 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [(8R,11S)-4-methyl-13,15-dioxatetracyclo[9.4.0.01,4.05,9]pentadeca-2,5(9)-dien-8-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@@H]1CCC2=C1C[C@H]1COCOC13C=CC23C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H25F3O5/c1-21-10-11-22(21)16(13-30-14-31-22)12-17-18(21)8-9-19(17)32-20(28)23(29-2,24(25,26)27)15-6-4-3-5-7-15/h3-7,10-11,16,19H,8-9,12-14H2,1-2H3/t16-,19+,21?,22?,23-/m0/s1 |
| InChIKey | DEUJNUCJMJZCEH-ZTHMCOKNSA-N |
| XLogP | 4.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|