C27H35F3O5 — CID 57247117
[(1S,2S)-2-[7-(oxan-2-yloxy)hept-3-enyl]cyclopent-3-en-1-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 57247117) has the molecular formula C27H35F3O5 and a molecular weight of 496.57 g/mol. Its IUPAC name is [(1S,2S)-2-[7-(oxan-2-yloxy)hept-3-enyl]cyclopent-3-en-1-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2S)-2-[7-(oxan-2-yloxy)hept-3-enyl]cyclopent-3-en-1-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 57247117 |
| Molecular Formula | C27H35F3O5 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [(1S,2S)-2-[7-(oxan-2-yloxy)hept-3-enyl]cyclopent-3-en-1-yl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)O[C@H]1CC=C[C@@H]1CCC=CCCCOC1CCCCO1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H35F3O5/c1-32-26(27(28,29)30,22-15-7-5-8-16-22)25(31)35-23-17-12-14-21(23)13-6-3-2-4-10-19-33-24-18-9-11-20-34-24/h2-3,5,7-8,12,14-16,21,23-24H,4,6,9-11,13,17-20H2,1H3/t21-,23-,24?,26?/m0/s1 |
| InChIKey | XHIJBDFSTAZLRX-KNXWDZBOSA-N |
| XLogP | 6.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|