C16H17F3O3 — CID 101465856
(2S,5S)-2-tert-butyl-5-phenyl-5-[(Z)-3,3,3-trifluoroprop-1-enyl]-1,3-dioxolan-4-one (PubChem CID 101465856) has the molecular formula C16H17F3O3 and a molecular weight of 314.30 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-phenyl-5-[(Z)-3,3,3-trifluoroprop-1-enyl]-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-phenyl-5-[(Z)-3,3,3-trifluoroprop-1-enyl]-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 101465856 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-phenyl-5-[(Z)-3,3,3-trifluoroprop-1-enyl]-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@](/C=C\C(F)(F)F)(c2ccccc2)O1 |
| InChI | InChI=1S/C16H17F3O3/c1-14(2,3)13-21-12(20)15(22-13,9-10-16(17,18)19)11-7-5-4-6-8-11/h4-10,13H,1-3H3/b10-9-/t13-,15+/m1/s1 |
| InChIKey | XSSLKXQPBOUOIV-OHXSVUBBSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|