C30H29NO5 — CID 139122093
[(4aS)-3-phenyl-2,4a-dihydro-1H-fluoren-4-yl] 4-nitrobenzoate;ethoxyethane (PubChem CID 139122093) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is [(4aS)-3-phenyl-2,4a-dihydro-1H-fluoren-4-yl] 4-nitrobenzoate;ethoxyethane.
| Compound Name | [(4aS)-3-phenyl-2,4a-dihydro-1H-fluoren-4-yl] 4-nitrobenzoate;ethoxyethane |
|---|---|
| PubChem CID | 139122093 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [(4aS)-3-phenyl-2,4a-dihydro-1H-fluoren-4-yl] 4-nitrobenzoate;ethoxyethane |
| SMILES | CCOCC.O=C(OC1=C(c2ccccc2)CCC2=Cc3ccccc3[C@H]21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H19NO4.C4H10O/c28-26(18-10-13-21(14-11-18)27(29)30)31-25-23(17-6-2-1-3-7-17)15-12-20-16-19-8-4-5-9-22(19)24(20)25;1-3-5-4-2/h1-11,13-14,16,24H,12,15H2;3-4H2,1-2H3/t24-;/m0./s1 |
| InChIKey | ZZHVCTYOCSZUIW-JIDHJSLPSA-N |
| XLogP | 7.18 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|