C44H39NO8 — CID 135060914
[2-phenyl-5-[(2S,4S,5S)-4-phenyl-2,5-bis(phenylmethoxymethyl)-1,3-dioxolan-4-yl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate (PubChem CID 135060914) has the molecular formula C44H39NO8 and a molecular weight of 709.80 g/mol. Its IUPAC name is [2-phenyl-5-[(2S,4S,5S)-4-phenyl-2,5-bis(phenylmethoxymethyl)-1,3-dioxolan-4-yl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate.
| Compound Name | [2-phenyl-5-[(2S,4S,5S)-4-phenyl-2,5-bis(phenylmethoxymethyl)-1,3-dioxolan-4-yl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 135060914 |
| Molecular Formula | C44H39NO8 |
| Molecular Weight | 709.80 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | [2-phenyl-5-[(2S,4S,5S)-4-phenyl-2,5-bis(phenylmethoxymethyl)-1,3-dioxolan-4-yl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate |
| SMILES | O=C(OC1=C(c2ccccc2)CCC([C@@]2(c3ccccc3)O[C@@H](COCc3ccccc3)O[C@H]2COCc2ccccc2)=C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C44H39NO8/c46-43(35-21-24-38(25-22-35)45(47)48)51-40-27-37(23-26-39(40)34-17-9-3-10-18-34)44(36-19-11-4-12-20-36)41(30-49-28-32-13-5-1-6-14-32)52-42(53-44)31-50-29-33-15-7-2-8-16-33/h1-22,24-25,27,41-42H,23,26,28-31H2/t41-,42-,44+/m0/s1 |
| InChIKey | PBJZNMZKYVOVSP-PEKCXUPYSA-N |
| XLogP | 8.95 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.80 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|