C64H58N2O8 — CID 139122095
[2-phenyl-5-[(1S,6R)-7-phenyl-7-bicyclo[4.1.0]heptanyl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate (PubChem CID 139122095) has the molecular formula C64H58N2O8 and a molecular weight of 983.17 g/mol. Its IUPAC name is [2-phenyl-5-[(1S,6R)-7-phenyl-7-bicyclo[4.1.0]heptanyl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate.
| Compound Name | [2-phenyl-5-[(1S,6R)-7-phenyl-7-bicyclo[4.1.0]heptanyl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139122095 |
| Molecular Formula | C64H58N2O8 |
| Molecular Weight | 983.17 g/mol |
| Exact Mass | 982.42 |
| IUPAC Name | [2-phenyl-5-[(1S,6R)-7-phenyl-7-bicyclo[4.1.0]heptanyl]cyclohexa-1,5-dien-1-yl] 4-nitrobenzoate |
| SMILES | O=C(OC1=C(c2ccccc2)CCC(C2(c3ccccc3)[C@@H]3CCCC[C@@H]32)=C1)c1ccc([N+](=O)[O-])cc1.O=C(OC1=C(c2ccccc2)CCC(C2(c3ccccc3)[C@@H]3CCCC[C@@H]32)=C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C32H29NO4/c2*34-31(23-15-18-26(19-16-23)33(35)36)37-30-21-25(17-20-27(30)22-9-3-1-4-10-22)32(24-11-5-2-6-12-24)28-13-7-8-14-29(28)32/h2*1-6,9-12,15-16,18-19,21,28-29H,7-8,13-14,17,20H2/t2*28-,29+,32? |
| InChIKey | UHYWWMCTRRIDCM-KPSYKKQFSA-N |
| XLogP | 15.28 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.17 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|