C16H13NO6 — CID 87642764
[(2S,3S)-3-(4-nitrophenyl)-3-phenyloxiran-2-yl]methyl hydrogen carbonate (PubChem CID 87642764) has the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. Its IUPAC name is [(2S,3S)-3-(4-nitrophenyl)-3-phenyloxiran-2-yl]methyl hydrogen carbonate.
| Compound Name | [(2S,3S)-3-(4-nitrophenyl)-3-phenyloxiran-2-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 87642764 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [(2S,3S)-3-(4-nitrophenyl)-3-phenyloxiran-2-yl]methyl hydrogen carbonate |
| SMILES | O=C(O)OC[C@@H]1O[C@@]1(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13NO6/c18-15(19)22-10-14-16(23-14,11-4-2-1-3-5-11)12-6-8-13(9-7-12)17(20)21/h1-9,14H,10H2,(H,18,19)/t14-,16-/m0/s1 |
| InChIKey | VBVWLZGKMRYSHI-HOCLYGCPSA-N |
| XLogP | 2.93 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|