C16H14N4O4 — CID 139122547
2-[1-(3,5-dinitrophenyl)-1-(1H-pyrrol-2-yl)ethyl]-1H-pyrrole (PubChem CID 139122547) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[1-(3,5-dinitrophenyl)-1-(1H-pyrrol-2-yl)ethyl]-1H-pyrrole.
| Compound Name | 2-[1-(3,5-dinitrophenyl)-1-(1H-pyrrol-2-yl)ethyl]-1H-pyrrole |
|---|---|
| PubChem CID | 139122547 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[1-(3,5-dinitrophenyl)-1-(1H-pyrrol-2-yl)ethyl]-1H-pyrrole |
| SMILES | CC(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)(c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C16H14N4O4/c1-16(14-4-2-6-17-14,15-5-3-7-18-15)11-8-12(19(21)22)10-13(9-11)20(23)24/h2-10,17-18H,1H3 |
| InChIKey | GIYAAQWVJGRGDK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|