C30H27BrN2O2 — CID 139122692
methyl (2R,3E)-2-[(4-bromophenyl)methyl]-3-(diphenylhydrazinylidene)-2-(4-methylphenyl)propanoate (PubChem CID 139122692) has the molecular formula C30H27BrN2O2 and a molecular weight of 527.46 g/mol. Its IUPAC name is methyl (2R,3E)-2-[(4-bromophenyl)methyl]-3-(diphenylhydrazinylidene)-2-(4-methylphenyl)propanoate.
| Compound Name | methyl (2R,3E)-2-[(4-bromophenyl)methyl]-3-(diphenylhydrazinylidene)-2-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 139122692 |
| Molecular Formula | C30H27BrN2O2 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | methyl (2R,3E)-2-[(4-bromophenyl)methyl]-3-(diphenylhydrazinylidene)-2-(4-methylphenyl)propanoate |
| SMILES | COC(=O)[C@](/C=N/N(c1ccccc1)c1ccccc1)(Cc1ccc(Br)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H27BrN2O2/c1-23-13-17-25(18-14-23)30(29(34)35-2,21-24-15-19-26(31)20-16-24)22-32-33(27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-20,22H,21H2,1-2H3/b32-22+/t30-/m0/s1 |
| InChIKey | UEVHPTFLCUHNST-UMGQPVNOSA-N |
| XLogP | 7.24 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|