C41H61NO14 — CID 139124350
diethyl 5-[[3,5-bis(ethoxycarbonyl)anilino]methyl]benzene-1,3-dicarboxylate;1,4,7,10,13,16-hexaoxacyclodocosane (PubChem CID 139124350) has the molecular formula C41H61NO14 and a molecular weight of 791.93 g/mol. Its IUPAC name is diethyl 5-[[3,5-bis(ethoxycarbonyl)anilino]methyl]benzene-1,3-dicarboxylate;1,4,7,10,13,16-hexaoxacyclodocosane.
| Compound Name | diethyl 5-[[3,5-bis(ethoxycarbonyl)anilino]methyl]benzene-1,3-dicarboxylate;1,4,7,10,13,16-hexaoxacyclodocosane |
|---|---|
| PubChem CID | 139124350 |
| Molecular Formula | C41H61NO14 |
| Molecular Weight | 791.93 g/mol |
| Exact Mass | 791.41 |
| IUPAC Name | diethyl 5-[[3,5-bis(ethoxycarbonyl)anilino]methyl]benzene-1,3-dicarboxylate;1,4,7,10,13,16-hexaoxacyclodocosane |
| SMILES | C1CCCOCCOCCOCCOCCOCCOCC1.CCOC(=O)c1cc(CNc2cc(C(=O)OCC)cc(C(=O)OCC)c2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C25H29NO8.C16H32O6/c1-5-31-22(27)17-9-16(10-18(11-17)23(28)32-6-2)15-26-21-13-19(24(29)33-7-3)12-20(14-21)25(30)34-8-4;1-2-4-6-18-8-10-20-12-14-22-16-15-21-13-11-19-9-7-17-5-3-1/h9-14,26H,5-8,15H2,1-4H3;1-16H2 |
| InChIKey | UOZYLPJUQMRCBP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 172.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|