C66H75N9O18 — CID 139125400
(4-propan-2-yl-1-pyridin-4-ylcyclohexyl)methyl 3,5-dinitrobenzoate (PubChem CID 139125400) has the molecular formula C66H75N9O18 and a molecular weight of 1282.37 g/mol. Its IUPAC name is (4-propan-2-yl-1-pyridin-4-ylcyclohexyl)methyl 3,5-dinitrobenzoate.
| Compound Name | (4-propan-2-yl-1-pyridin-4-ylcyclohexyl)methyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139125400 |
| Molecular Formula | C66H75N9O18 |
| Molecular Weight | 1282.37 g/mol |
| Exact Mass | 1281.52 |
| IUPAC Name | (4-propan-2-yl-1-pyridin-4-ylcyclohexyl)methyl 3,5-dinitrobenzoate |
| SMILES | CC(C)[C@H]1CC[C@@](COC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)(c2ccncc2)CC1.CC(C)[C@H]1CC[C@@](COC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)(c2ccncc2)CC1.CC(C)[C@H]1CC[C@@](COC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)(c2ccncc2)CC1 |
| InChI | InChI=1S/3C22H25N3O6/c3*1-15(2)16-3-7-22(8-4-16,18-5-9-23-10-6-18)14-31-21(26)17-11-19(24(27)28)13-20(12-17)25(29)30/h3*5-6,9-13,15-16H,3-4,7-8,14H2,1-2H3/t3*16-,22+ |
| InChIKey | ZPLHVWUPAAXNAH-BWZLVTAQSA-N |
| XLogP | 14.52 |
| TPSA | 376.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1282.37 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|