C42H38N8O16 — CID 139147370
bis(4-(dimethylamino)benzoic acid);bis(3,5-dinitrobenzoic acid);4-pyridin-4-ylpyridine (PubChem CID 139147370) has the molecular formula C42H38N8O16 and a molecular weight of 910.81 g/mol. Its IUPAC name is bis(4-(dimethylamino)benzoic acid);bis(3,5-dinitrobenzoic acid);4-pyridin-4-ylpyridine.
| Compound Name | bis(4-(dimethylamino)benzoic acid);bis(3,5-dinitrobenzoic acid);4-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 139147370 |
| Molecular Formula | C42H38N8O16 |
| Molecular Weight | 910.81 g/mol |
| Exact Mass | 910.24 |
| IUPAC Name | bis(4-(dimethylamino)benzoic acid);bis(3,5-dinitrobenzoic acid);4-pyridin-4-ylpyridine |
| SMILES | CN(C)c1ccc(C(=O)O)cc1.CN(C)c1ccc(C(=O)O)cc1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C9H11NO2.2C7H4N2O6/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*1-10(2)8-5-3-7(4-6-8)9(11)12;2*10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-8H;2*3-6H,1-2H3,(H,11,12);2*1-3H,(H,10,11) |
| InChIKey | CYPTWQHAHBDIEA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 354.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.81 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|