About bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform
bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform (PubChem CID 139125564) has the molecular formula C20H18Br2Cl6N2O6
and a molecular weight of 754.90 g/mol. Its IUPAC name is bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform.
Molecular Properties
| Compound Name | bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform |
| PubChem CID | 139125564 |
| Molecular Formula | C20H18Br2Cl6N2O6 |
| Molecular Weight | 754.90 g/mol |
| Exact Mass | 749.77 |
| IUPAC Name | bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform |
| SMILES | COc1cc(Br)c2c(c1/N=N/c1c(OC)cc(Br)c3c1OCCO3)OCCO2.ClC(Cl)Cl.ClC(Cl)Cl |
| InChI | InChI=1S/C18H16Br2N2O6.2CHCl3/c1-23-11-7-9(19)15-17(27-5-3-25-15)13(11)21-22-14-12(24-2)8-10(20)16-18(14)28-6-4-26-16;2*2-1(3)4/h7-8H,3-6H2,1-2H3;2*1H/b22-21+;; |
| InChIKey | HBWIBSWRTYZLID-ZPZFBZIMSA-N |
| XLogP | 9.16 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 754.90 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform?
The IUPAC name of bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform (CID 139125564) is bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform.
What is the SMILES notation for bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform?
The canonical SMILES for bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform is COc1cc(Br)c2c(c1/N=N/c1c(OC)cc(Br)c3c1OCCO3)OCCO2.ClC(Cl)Cl.ClC(Cl)Cl.
What is the InChIKey of bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform?
The InChIKey is HBWIBSWRTYZLID-ZPZFBZIMSA-N. The full InChI is InChI=1S/C18H16Br2N2O6.2CHCl3/c1-23-11-7-9(19)15-17(27-5-3-25-15)13(11)21-22-14-12(24-2)8-10(20)16-18(14)28-6-4-26-16;2*2-1(3)4/h7-8H,3-6H2,1-2H3;2*1H/b22-21+;;.
What are the key properties of bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform?
bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform has a molecular weight of 754.90 g/mol, XLogP of 9.16, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-bromo-6-methoxy-2,3-dihydro-1,4-benzodioxin-5-yl)diazene;chloroform is sourced from PubChem (CID 139125564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).