About diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide
diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide (PubChem CID 139126138) has the molecular formula CH6F5N5O2S
and a molecular weight of 247.15 g/mol. Its IUPAC name is diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide.
Molecular Properties
| Compound Name | diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide |
| PubChem CID | 139126138 |
| Molecular Formula | CH6F5N5O2S |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide |
| SMILES | NC(N)=[NH2+].O=[N+]([O-])[N-]S(F)(F)(F)(F)F |
| InChI | InChI=1S/CH5N3.F5N2O2S/c2-1(3)4;1-10(2,3,4,5)6-7(8)9/h(H5,2,3,4);/q;-1/p+1 |
| InChIKey | FRKFVLOCWUQYTD-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide?
The IUPAC name of diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide (CID 139126138) is diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide.
What is the SMILES notation for diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide?
The canonical SMILES for diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide is NC(N)=[NH2+].O=[N+]([O-])[N-]S(F)(F)(F)(F)F.
What is the InChIKey of diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide?
The InChIKey is FRKFVLOCWUQYTD-UHFFFAOYSA-O. The full InChI is InChI=1S/CH5N3.F5N2O2S/c2-1(3)4;1-10(2,3,4,5)6-7(8)9/h(H5,2,3,4);/q;-1/p+1.
What are the key properties of diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide?
diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide has a molecular weight of 247.15 g/mol, XLogP of -0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylideneazanium;nitro-(pentafluoro-λ6-sulfanyl)azanide is sourced from PubChem (CID 139126138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).