C5H7F4N11O3 — CID 139255650
[amino-(carbamoylamino)methylidene]azanium;[4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide (PubChem CID 139255650) has the molecular formula C5H7F4N11O3 and a molecular weight of 345.18 g/mol. Its IUPAC name is [amino-(carbamoylamino)methylidene]azanium;[4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide.
| Compound Name | [amino-(carbamoylamino)methylidene]azanium;[4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide |
|---|---|
| PubChem CID | 139255650 |
| Molecular Formula | C5H7F4N11O3 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | [amino-(carbamoylamino)methylidene]azanium;[4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide |
| SMILES | NC(=[NH2+])NC(N)=O.O=[N+]([O-])[N-]c1nc(N(F)F)nc(N(F)F)n1 |
| InChI | InChI=1S/C3F4N7O2.C2H6N4O/c4-12(5)2-8-1(11-14(15)16)9-3(10-2)13(6)7;3-1(4)6-2(5)7/h;(H6,3,4,5,6,7)/q-1;/p+1 |
| InChIKey | ZHKWQMOLWKCKRR-UHFFFAOYSA-O |
| XLogP | -2.05 |
| TPSA | 209.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|