C5H11N11O3 — CID 139255652
[amino-(carbamoylamino)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255652) has the molecular formula C5H11N11O3 and a molecular weight of 273.22 g/mol. Its IUPAC name is [amino-(carbamoylamino)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | [amino-(carbamoylamino)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255652 |
| Molecular Formula | C5H11N11O3 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [amino-(carbamoylamino)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | NC(=[NH2+])NC(N)=O.Nc1nc(N)nc([N-][N+](=O)[O-])n1 |
| InChI | InChI=1S/C3H4N7O2.C2H6N4O/c4-1-6-2(5)8-3(7-1)9-10(11)12;3-1(4)6-2(5)7/h(H4-,4,5,6,7,8,9);(H6,3,4,5,6,7)/q-1;/p+1 |
| InChIKey | WPXGVFGZVLJYSD-UHFFFAOYSA-O |
| XLogP | -4.04 |
| TPSA | 254.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|