C2H8FN4O4P — CID 139061263
[amino-(carbamoylamino)methylidene]azanium;fluoro(hydroxy)phosphinate (PubChem CID 139061263) has the molecular formula C2H8FN4O4P and a molecular weight of 202.08 g/mol. Its IUPAC name is [amino-(carbamoylamino)methylidene]azanium;fluoro(hydroxy)phosphinate.
| Compound Name | [amino-(carbamoylamino)methylidene]azanium;fluoro(hydroxy)phosphinate |
|---|---|
| PubChem CID | 139061263 |
| Molecular Formula | C2H8FN4O4P |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | [amino-(carbamoylamino)methylidene]azanium;fluoro(hydroxy)phosphinate |
| SMILES | NC(=[NH2+])NC(N)=O.O=P([O-])(O)F |
| InChI | InChI=1S/C2H6N4O.FH2O3P/c3-1(4)6-2(5)7;1-5(2,3)4/h(H6,3,4,5,6,7);(H2,2,3,4) |
| InChIKey | NAZWIQOWFRUJAC-UHFFFAOYSA-N |
| XLogP | -3.85 |
| TPSA | 167.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|