About potassium;azane;(carbamoylamino) hydrogen phosphate
potassium;azane;(carbamoylamino) hydrogen phosphate (PubChem CID 173033502) has the molecular formula CH7KN3O5P
and a molecular weight of 211.16 g/mol. Its IUPAC name is potassium;azane;(carbamoylamino) hydrogen phosphate.
Molecular Properties
| Compound Name | potassium;azane;(carbamoylamino) hydrogen phosphate |
| PubChem CID | 173033502 |
| Molecular Formula | CH7KN3O5P |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | potassium;azane;(carbamoylamino) hydrogen phosphate |
| SMILES | N.NC(=O)NOP(=O)([O-])O.[K+] |
| InChI | InChI=1S/CH5N2O5P.K.H3N/c2-1(4)3-8-9(5,6)7;;/h(H3,2,3,4)(H2,5,6,7);;1H3/q;+1;/p-1 |
| InChIKey | LUZOZJBNGJTDGT-UHFFFAOYSA-M |
| XLogP | -4.79 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;azane;(carbamoylamino) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;azane;(carbamoylamino) hydrogen phosphate?
The IUPAC name of potassium;azane;(carbamoylamino) hydrogen phosphate (CID 173033502) is potassium;azane;(carbamoylamino) hydrogen phosphate.
What is the SMILES notation for potassium;azane;(carbamoylamino) hydrogen phosphate?
The canonical SMILES for potassium;azane;(carbamoylamino) hydrogen phosphate is N.NC(=O)NOP(=O)([O-])O.[K+].
What is the InChIKey of potassium;azane;(carbamoylamino) hydrogen phosphate?
The InChIKey is LUZOZJBNGJTDGT-UHFFFAOYSA-M. The full InChI is InChI=1S/CH5N2O5P.K.H3N/c2-1(4)3-8-9(5,6)7;;/h(H3,2,3,4)(H2,5,6,7);;1H3/q;+1;/p-1.
What are the key properties of potassium;azane;(carbamoylamino) hydrogen phosphate?
potassium;azane;(carbamoylamino) hydrogen phosphate has a molecular weight of 211.16 g/mol, XLogP of -4.79, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;azane;(carbamoylamino) hydrogen phosphate is sourced from PubChem (CID 173033502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).