C5H7N15O3 — CID 139255648
[amino-(carbamoylamino)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255648) has the molecular formula C5H7N15O3 and a molecular weight of 325.21 g/mol. Its IUPAC name is [amino-(carbamoylamino)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | [amino-(carbamoylamino)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255648 |
| Molecular Formula | C5H7N15O3 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [amino-(carbamoylamino)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | NC(=[NH2+])NC(N)=O.[N-]=[N+]=Nc1nc(N=[N+]=[N-])nc([N-][N+](=O)[O-])n1 |
| InChI | InChI=1S/C3N11O2.C2H6N4O/c4-12-9-1-6-2(10-13-5)8-3(7-1)11-14(15)16;3-1(4)6-2(5)7/h;(H6,3,4,5,6,7)/q-1;/p+1 |
| InChIKey | GZJOFZMSRCHYJW-UHFFFAOYSA-O |
| XLogP | -1.32 |
| TPSA | 300.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|