C4H10N10O2 — CID 139255631
diaminomethylideneazanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255631) has the molecular formula C4H10N10O2 and a molecular weight of 230.19 g/mol. Its IUPAC name is diaminomethylideneazanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | diaminomethylideneazanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255631 |
| Molecular Formula | C4H10N10O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | diaminomethylideneazanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | NC(N)=[NH2+].Nc1nc(N)nc([N-][N+](=O)[O-])n1 |
| InChI | InChI=1S/C3H4N7O2.CH5N3/c4-1-6-2(5)8-3(7-1)9-10(11)12;2-1(3)4/h(H4-,4,5,6,7,8,9);(H5,2,3,4)/q-1;/p+1 |
| InChIKey | TVSJRACWWFKWOS-UHFFFAOYSA-O |
| XLogP | -3.75 |
| TPSA | 225.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|