C10H15N4O2+ — CID 139130858
2-(1H-imidazol-5-yl)-4,4,5,5-tetramethyl-3-oxidoimidazole-1,3-diium 1-oxide (PubChem CID 139130858) has the molecular formula C10H15N4O2+ and a molecular weight of 223.26 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)-4,4,5,5-tetramethyl-3-oxidoimidazole-1,3-diium 1-oxide.
| Compound Name | 2-(1H-imidazol-5-yl)-4,4,5,5-tetramethyl-3-oxidoimidazole-1,3-diium 1-oxide |
|---|---|
| PubChem CID | 139130858 |
| Molecular Formula | C10H15N4O2+ |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(1H-imidazol-5-yl)-4,4,5,5-tetramethyl-3-oxidoimidazole-1,3-diium 1-oxide |
| SMILES | CC1(C)[N+](=O)C(c2cnc[nH]2)=[N+]([O-])C1(C)C |
| InChI | InChI=1S/C10H15N4O2/c1-9(2)10(3,4)14(16)8(13(9)15)7-5-11-6-12-7/h5-6H,1-4H3,(H,11,12)/q+1 |
| InChIKey | JBYLCJJYBQKTRZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|