C16H20F6N4O6S3 — CID 139132431
1-[4-(dimethylamino)pyridin-1-ium-1-yl]sulfanyl-N,N-dimethylpyridin-1-ium-4-amine;bis(trifluoromethanesulfonate) (PubChem CID 139132431) has the molecular formula C16H20F6N4O6S3 and a molecular weight of 574.55 g/mol. Its IUPAC name is 1-[4-(dimethylamino)pyridin-1-ium-1-yl]sulfanyl-N,N-dimethylpyridin-1-ium-4-amine;bis(trifluoromethanesulfonate).
| Compound Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]sulfanyl-N,N-dimethylpyridin-1-ium-4-amine;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139132431 |
| Molecular Formula | C16H20F6N4O6S3 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]sulfanyl-N,N-dimethylpyridin-1-ium-4-amine;bis(trifluoromethanesulfonate) |
| SMILES | CN(C)c1cc[n+](S[n+]2ccc(N(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H20N4S.2CHF3O3S/c1-15(2)13-5-9-17(10-6-13)19-18-11-7-14(8-12-18)16(3)4;2*2-1(3,4)8(5,6)7/h5-12H,1-4H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | IVMMZAYBWMNPCX-UHFFFAOYSA-L |
| XLogP | 1.46 |
| TPSA | 128.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|