C51H53B3F2O2 — CID 139142071
[4-[6-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-2,2-difluoro-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-dien-4-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 139142071) has the molecular formula C51H53B3F2O2 and a molecular weight of 768.41 g/mol. Its IUPAC name is [4-[6-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-2,2-difluoro-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-dien-4-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[6-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-2,2-difluoro-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-dien-4-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 139142071 |
| Molecular Formula | C51H53B3F2O2 |
| Molecular Weight | 768.41 g/mol |
| Exact Mass | 768.43 |
| IUPAC Name | [4-[6-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]-2,2-difluoro-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-dien-4-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(C3=CC(c4ccc(B(c5c(C)cc(C)cc5C)c5c(C)cc(C)cc5C)cc4)=[O+][B-](F)(F)O3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C51H53B3F2O2/c1-30-21-34(5)48(35(6)22-30)52(49-36(7)23-31(2)24-37(49)8)44-17-13-42(14-18-44)46-29-47(58-54(55,56)57-46)43-15-19-45(20-16-43)53(50-38(9)25-32(3)26-39(50)10)51-40(11)27-33(4)28-41(51)12/h13-29H,1-12H3 |
| InChIKey | IEOPIYWQDCITIV-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.41 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|