C46H39BF15O2P — CID 102289183
[(Z)-4-oxo-1,4-diphenyl-3-tritert-butylphosphaniumylbut-1-enoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 102289183) has the molecular formula C46H39BF15O2P and a molecular weight of 950.57 g/mol. Its IUPAC name is [(Z)-4-oxo-1,4-diphenyl-3-tritert-butylphosphaniumylbut-1-enoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [(Z)-4-oxo-1,4-diphenyl-3-tritert-butylphosphaniumylbut-1-enoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 102289183 |
| Molecular Formula | C46H39BF15O2P |
| Molecular Weight | 950.57 g/mol |
| Exact Mass | 950.25 |
| IUPAC Name | [(Z)-4-oxo-1,4-diphenyl-3-tritert-butylphosphaniumylbut-1-enoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)(C)[P+](C(/C=C(\O[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1)C(=O)c1ccccc1)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C46H39BF15O2P/c1-44(2,3)65(45(4,5)6,46(7,8)9)24(43(63)22-18-14-11-15-19-22)20-23(21-16-12-10-13-17-21)64-47(25-28(48)34(54)40(60)35(55)29(25)49,26-30(50)36(56)41(61)37(57)31(26)51)27-32(52)38(58)42(62)39(59)33(27)53/h10-20,24H,1-9H3/b23-20- |
| InChIKey | UVIBKEMNPFKBRT-ATJXCDBQSA-N |
| XLogP | 12.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.57 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|