C50H43BF6O5P2 — CID 139734296
[3,5-bis(trifluoromethyl)phenyl] bis(methyl-phenacyl-diphenyl-λ5-phosphanyl) borate (PubChem CID 139734296) has the molecular formula C50H43BF6O5P2 and a molecular weight of 910.64 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis(methyl-phenacyl-diphenyl-λ5-phosphanyl) borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis(methyl-phenacyl-diphenyl-λ5-phosphanyl) borate |
|---|---|
| PubChem CID | 139734296 |
| Molecular Formula | C50H43BF6O5P2 |
| Molecular Weight | 910.64 g/mol |
| Exact Mass | 910.26 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis(methyl-phenacyl-diphenyl-λ5-phosphanyl) borate |
| SMILES | CP(CC(=O)c1ccccc1)(OB(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OP(C)(CC(=O)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H43BF6O5P2/c1-63(43-25-13-5-14-26-43,44-27-15-6-16-28-44,36-47(58)38-21-9-3-10-22-38)61-51(60-42-34-40(49(52,53)54)33-41(35-42)50(55,56)57)62-64(2,45-29-17-7-18-30-45,46-31-19-8-20-32-46)37-48(59)39-23-11-4-12-24-39/h3-35H,36-37H2,1-2H3 |
| InChIKey | WEBNGOJQSWDERZ-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.64 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|