C66H59BF6O5P2 — CID 139734259
[3,5-bis(trifluoromethyl)phenyl] bis[tris(4-methylphenyl)-phenacyl-λ5-phosphanyl] borate (PubChem CID 139734259) has the molecular formula C66H59BF6O5P2 and a molecular weight of 1118.94 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] bis[tris(4-methylphenyl)-phenacyl-λ5-phosphanyl] borate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(4-methylphenyl)-phenacyl-λ5-phosphanyl] borate |
|---|---|
| PubChem CID | 139734259 |
| Molecular Formula | C66H59BF6O5P2 |
| Molecular Weight | 1118.94 g/mol |
| Exact Mass | 1118.38 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] bis[tris(4-methylphenyl)-phenacyl-λ5-phosphanyl] borate |
| SMILES | Cc1ccc(P(CC(=O)c2ccccc2)(OB(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)OP(CC(=O)c2ccccc2)(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C66H59BF6O5P2/c1-46-17-29-57(30-18-46)79(58-31-19-47(2)20-32-58,59-33-21-48(3)22-34-59,44-63(74)52-13-9-7-10-14-52)77-67(76-56-42-54(65(68,69)70)41-55(43-56)66(71,72)73)78-80(60-35-23-49(4)24-36-60,61-37-25-50(5)26-38-61,62-39-27-51(6)28-40-62)45-64(75)53-15-11-8-12-16-53/h7-43H,44-45H2,1-6H3 |
| InChIKey | URNNHRSHCPGMPL-UHFFFAOYSA-N |
| XLogP | 14.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.94 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|