C18H19N5O3 — CID 139146045
3-phenyldiazenylpyridin-1-ium-2,6-diamine;benzoate;hydrate (PubChem CID 139146045) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-phenyldiazenylpyridin-1-ium-2,6-diamine;benzoate;hydrate.
| Compound Name | 3-phenyldiazenylpyridin-1-ium-2,6-diamine;benzoate;hydrate |
|---|---|
| PubChem CID | 139146045 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-phenyldiazenylpyridin-1-ium-2,6-diamine;benzoate;hydrate |
| SMILES | Nc1ccc(/N=N/c2ccccc2)c(N)[nH+]1.O.O=C([O-])c1ccccc1 |
| InChI | InChI=1S/C11H11N5.C7H6O2.H2O/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;8-7(9)6-4-2-1-3-5-6;/h1-7H,(H4,12,13,14);1-5H,(H,8,9);1H2/b16-15+;; |
| InChIKey | ZCMCFIYCRCXCML-VRZXRVJBSA-N |
| XLogP | 1.31 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|