C18H19N5O4 — CID 139197220
2-carboxyphenolate;3-phenyldiazenylpyridin-1-ium-2,6-diamine;hydrate (PubChem CID 139197220) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-carboxyphenolate;3-phenyldiazenylpyridin-1-ium-2,6-diamine;hydrate.
| Compound Name | 2-carboxyphenolate;3-phenyldiazenylpyridin-1-ium-2,6-diamine;hydrate |
|---|---|
| PubChem CID | 139197220 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-carboxyphenolate;3-phenyldiazenylpyridin-1-ium-2,6-diamine;hydrate |
| SMILES | Nc1ccc(/N=N/c2ccccc2)c(N)[nH+]1.O.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C11H11N5.C7H6O3.H2O/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;8-6-4-2-1-3-5(6)7(9)10;/h1-7H,(H4,12,13,14);1-4,8H,(H,9,10);1H2/b16-15+;; |
| InChIKey | ZPKYQRUXNJNXMJ-VRZXRVJBSA-N |
| XLogP | 1.71 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|