C16H23NO5 — CID 139146822
2-[1-(azaniumylmethyl)cyclohexyl]acetate;3-hydroxybenzoic acid (PubChem CID 139146822) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-[1-(azaniumylmethyl)cyclohexyl]acetate;3-hydroxybenzoic acid.
| Compound Name | 2-[1-(azaniumylmethyl)cyclohexyl]acetate;3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139146822 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[1-(azaniumylmethyl)cyclohexyl]acetate;3-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(O)c1.[NH3+]CC1(CC(=O)[O-])CCCCC1 |
| InChI | InChI=1S/C9H17NO2.C7H6O3/c10-7-9(6-8(11)12)4-2-1-3-5-9;8-6-3-1-2-5(4-6)7(9)10/h1-7,10H2,(H,11,12);1-4,8H,(H,9,10) |
| InChIKey | BDBAHSIHOFGGMP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |