C25H19NO2 — CID 139148505
2-[(1R,2R)-2-[(E)-2-(4-phenylphenyl)ethenyl]cyclopropyl]isoindole-1,3-dione (PubChem CID 139148505) has the molecular formula C25H19NO2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[(1R,2R)-2-[(E)-2-(4-phenylphenyl)ethenyl]cyclopropyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2R)-2-[(E)-2-(4-phenylphenyl)ethenyl]cyclopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139148505 |
| Molecular Formula | C25H19NO2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[(1R,2R)-2-[(E)-2-(4-phenylphenyl)ethenyl]cyclopropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1C[C@@H]1/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19NO2/c27-24-21-8-4-5-9-22(21)25(28)26(24)23-16-20(23)15-12-17-10-13-19(14-11-17)18-6-2-1-3-7-18/h1-15,20,23H,16H2/b15-12+/t20-,23+/m0/s1 |
| InChIKey | QDMMLWHEUZZRHN-CKSDJQNESA-N |
| XLogP | 5.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|