C14H23OP — CID 139156126
(2R,3S)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-3-propyloxaphosphirane (PubChem CID 139156126) has the molecular formula C14H23OP and a molecular weight of 238.31 g/mol. Its IUPAC name is (2R,3S)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-3-propyloxaphosphirane.
| Compound Name | (2R,3S)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-3-propyloxaphosphirane |
|---|---|
| PubChem CID | 139156126 |
| Molecular Formula | C14H23OP |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (2R,3S)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-3-propyloxaphosphirane |
| SMILES | CCC[C@H]1O[P@]1C1(C)C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C14H23OP/c1-7-8-13-15-16(13)14(6)11(4)9(2)10(3)12(14)5/h13H,7-8H2,1-6H3/t13-,16-/m0/s1 |
| InChIKey | RVNWJQKXDWFCTI-BBRMVZONSA-N |
| XLogP | 4.98 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|