C25H29N3O2Pd — CID 139157153
3,5-ditert-butylbenzene-1,2-diolate;palladium(2+);phenyl(pyridin-2-yl)diazene (PubChem CID 139157153) has the molecular formula C25H29N3O2Pd and a molecular weight of 509.95 g/mol. Its IUPAC name is 3,5-ditert-butylbenzene-1,2-diolate;palladium(2+);phenyl(pyridin-2-yl)diazene.
| Compound Name | 3,5-ditert-butylbenzene-1,2-diolate;palladium(2+);phenyl(pyridin-2-yl)diazene |
|---|---|
| PubChem CID | 139157153 |
| Molecular Formula | C25H29N3O2Pd |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 3,5-ditert-butylbenzene-1,2-diolate;palladium(2+);phenyl(pyridin-2-yl)diazene |
| SMILES | CC(C)(C)c1cc([O-])c([O-])c(C(C)(C)C)c1.[Pd+2].c1ccc(/N=N/c2ccccn2)cc1 |
| InChI | InChI=1S/C14H22O2.C11H9N3.Pd/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12-11;/h7-8,15-16H,1-6H3;1-9H;/q;;+2/p-2/b;14-13+; |
| InChIKey | QUDMSWUTUQJDTQ-RXDJDOOOSA-L |
| XLogP | 5.92 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|