C29H33F3N2O2Zn — CID 139160121
zinc;2,6-ditert-butylphenolate;(Z)-1,1,1-trifluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate (PubChem CID 139160121) has the molecular formula C29H33F3N2O2Zn and a molecular weight of 563.98 g/mol. Its IUPAC name is zinc;2,6-ditert-butylphenolate;(Z)-1,1,1-trifluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate.
| Compound Name | zinc;2,6-ditert-butylphenolate;(Z)-1,1,1-trifluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate |
|---|---|
| PubChem CID | 139160121 |
| Molecular Formula | C29H33F3N2O2Zn |
| Molecular Weight | 563.98 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | zinc;2,6-ditert-butylphenolate;(Z)-1,1,1-trifluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate |
| SMILES | CC(/C=C(\[O-])C(F)(F)F)=N\c1cccc2ccc(C)nc12.CC(C)(C)c1cccc(C(C)(C)C)c1[O-].[Zn+2] |
| InChI | InChI=1S/C15H13F3N2O.C14H22O.Zn/c1-9-6-7-11-4-3-5-12(14(11)20-9)19-10(2)8-13(21)15(16,17)18;1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;/h3-8,21H,1-2H3;7-9,15H,1-6H3;/q;;+2/p-2/b13-8-,19-10+;; |
| InChIKey | DFRKLDUEDJVPSQ-SMFDEYJFSA-L |
| XLogP | 6.79 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.98 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|