C38H28BCl3N2O2 — CID 139161522
1-(4-carbazol-9-ylphenyl)-6,16-dimethyl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9(21),10,12,14(19),15,17-nonaene;chloroform (PubChem CID 139161522) has the molecular formula C38H28BCl3N2O2 and a molecular weight of 661.83 g/mol. Its IUPAC name is 1-(4-carbazol-9-ylphenyl)-6,16-dimethyl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9(21),10,12,14(19),15,17-nonaene;chloroform.
| Compound Name | 1-(4-carbazol-9-ylphenyl)-6,16-dimethyl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9(21),10,12,14(19),15,17-nonaene;chloroform |
|---|---|
| PubChem CID | 139161522 |
| Molecular Formula | C38H28BCl3N2O2 |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 660.13 |
| IUPAC Name | 1-(4-carbazol-9-ylphenyl)-6,16-dimethyl-2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9(21),10,12,14(19),15,17-nonaene;chloroform |
| SMILES | Cc1ccc2c(c1)-c1cccc3[n+]1[B-](c1ccc(-n4c5ccccc5c5ccccc54)cc1)(O2)Oc1ccc(C)cc1-3.ClC(Cl)Cl |
| InChI | InChI=1S/C37H27BN2O2.CHCl3/c1-24-14-20-36-30(22-24)34-12-7-13-35-31-23-25(2)15-21-37(31)42-38(41-36,40(34)35)26-16-18-27(19-17-26)39-32-10-5-3-8-28(32)29-9-4-6-11-33(29)39;2-1(3)4/h3-23H,1-2H3;1H |
| InChIKey | JCEXSUGKSRKUDV-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|