C43H41BN2O2 — CID 101395368
N,N-bis(4-butylphenyl)-4-(2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-1-yl)aniline (PubChem CID 101395368) has the molecular formula C43H41BN2O2 and a molecular weight of 628.62 g/mol. Its IUPAC name is N,N-bis(4-butylphenyl)-4-(2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-1-yl)aniline.
| Compound Name | N,N-bis(4-butylphenyl)-4-(2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-1-yl)aniline |
|---|---|
| PubChem CID | 101395368 |
| Molecular Formula | C43H41BN2O2 |
| Molecular Weight | 628.62 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | N,N-bis(4-butylphenyl)-4-(2,20-dioxa-21-azonia-1-boranuidapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9(21),10,12,14,16,18-nonaen-1-yl)aniline |
| SMILES | CCCCc1ccc(N(c2ccc(CCCC)cc2)c2ccc([B-]34Oc5ccccc5-c5cccc([n+]53)-c3ccccc3O4)cc2)cc1 |
| InChI | InChI=1S/C43H41BN2O2/c1-3-5-12-32-20-26-35(27-21-32)45(36-28-22-33(23-29-36)13-6-4-2)37-30-24-34(25-31-37)44-46-40(38-14-7-9-18-42(38)47-44)16-11-17-41(46)39-15-8-10-19-43(39)48-44/h7-11,14-31H,3-6,12-13H2,1-2H3 |
| InChIKey | QLRQCCYGCRPACU-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.62 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|