About nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde)
nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) (PubChem CID 139174382) has the molecular formula C32H22N4NiO2
and a molecular weight of 553.25 g/mol. Its IUPAC name is nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde).
Molecular Properties
| Compound Name | nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) |
| PubChem CID | 139174382 |
| Molecular Formula | C32H22N4NiO2 |
| Molecular Weight | 553.25 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) |
| SMILES | O=Cc1ccc(/C(=C2\C=CC=N2)c2ccc[n-]2)cc1.O=Cc1ccc(/C(=C2\C=CC=N2)c2ccc[n-]2)cc1.[Ni+2] |
| InChI | InChI=1S/2C16H11N2O.Ni/c2*19-11-12-5-7-13(8-6-12)16(14-3-1-9-17-14)15-4-2-10-18-15;/h2*1-11H;/q2*-1;+2 |
| InChIKey | LJVAVLCAHHPQJG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.25 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde)?
The IUPAC name of nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) (CID 139174382) is nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde).
What is the SMILES notation for nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde)?
The canonical SMILES for nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) is O=Cc1ccc(/C(=C2\C=CC=N2)c2ccc[n-]2)cc1.O=Cc1ccc(/C(=C2\C=CC=N2)c2ccc[n-]2)cc1.[Ni+2].
What is the InChIKey of nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde)?
The InChIKey is LJVAVLCAHHPQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H11N2O.Ni/c2*19-11-12-5-7-13(8-6-12)16(14-3-1-9-17-14)15-4-2-10-18-15;/h2*1-11H;/q2*-1;+2.
What are the key properties of nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde)?
nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) has a molecular weight of 553.25 g/mol, XLogP of 5.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis(4-[(Z)-pyrrol-1-id-2-yl(pyrrol-2-ylidene)methyl]benzaldehyde) is sourced from PubChem (CID 139174382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).