C27H23BClF10NSi2 — CID 139174434
chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-pyridin-1-ium-1-ylboranuide (PubChem CID 139174434) has the molecular formula C27H23BClF10NSi2 and a molecular weight of 653.91 g/mol. Its IUPAC name is chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-pyridin-1-ium-1-ylboranuide.
| Compound Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139174434 |
| Molecular Formula | C27H23BClF10NSi2 |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.10 |
| IUPAC Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[(E)-1-(2,3,4,5,6-pentafluorophenyl)-2,4-bis(trimethylsilyl)but-1-en-3-ynyl]-pyridin-1-ium-1-ylboranuide |
| SMILES | C[Si](C)(C)C#C/C(=C(\c1c(F)c(F)c(F)c(F)c1F)[B@-](Cl)(c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C27H23BClF10NSi2/c1-41(2,3)13-10-14(42(4,5)6)16(15-18(30)22(34)26(38)23(35)19(15)31)28(29,40-11-8-7-9-12-40)17-20(32)24(36)27(39)25(37)21(17)33/h7-9,11-12H,1-6H3/b16-14-/t28-/m1/s1 |
| InChIKey | IJHGNIQESDMIJN-CKFLREPLSA-N |
| XLogP | 7.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|