C32H26N8O2 — CID 139175982
4,6-bis[(3-aminoisoindol-1-ylidene)amino]benzene-1,3-diol;bis(pyridine) (PubChem CID 139175982) has the molecular formula C32H26N8O2 and a molecular weight of 554.61 g/mol. Its IUPAC name is 4,6-bis[(3-aminoisoindol-1-ylidene)amino]benzene-1,3-diol;bis(pyridine).
| Compound Name | 4,6-bis[(3-aminoisoindol-1-ylidene)amino]benzene-1,3-diol;bis(pyridine) |
|---|---|
| PubChem CID | 139175982 |
| Molecular Formula | C32H26N8O2 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 4,6-bis[(3-aminoisoindol-1-ylidene)amino]benzene-1,3-diol;bis(pyridine) |
| SMILES | NC1=N/C(=N\c2cc(/N=C3\N=C(N)c4ccccc43)c(O)cc2O)c2ccccc21.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C22H16N6O2.2C5H5N/c23-19-11-5-1-3-7-13(11)21(27-19)25-15-9-16(18(30)10-17(15)29)26-22-14-8-4-2-6-12(14)20(24)28-22;2*1-2-4-6-5-3-1/h1-10,29-30H,(H2,23,25,27)(H2,24,26,28);2*1-5H |
| InChIKey | VTGLXSMFJYDRAY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 167.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|