C48H41Cl3O8Si — CID 139180625
[(1R,6R,7S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(pyrene-1-carbonyloxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate;chloroform (PubChem CID 139180625) has the molecular formula C48H41Cl3O8Si and a molecular weight of 880.29 g/mol. Its IUPAC name is [(1R,6R,7S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(pyrene-1-carbonyloxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate;chloroform.
| Compound Name | [(1R,6R,7S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(pyrene-1-carbonyloxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate;chloroform |
|---|---|
| PubChem CID | 139180625 |
| Molecular Formula | C48H41Cl3O8Si |
| Molecular Weight | 880.29 g/mol |
| Exact Mass | 878.16 |
| IUPAC Name | [(1R,6R,7S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(pyrene-1-carbonyloxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] pyrene-1-carboxylate;chloroform |
| SMILES | CC(C)(C)[Si](C)(C)OC1[C@H]2OC3OC([C@H]2OC(=O)c2ccc4ccc5cccc6ccc2c4c56)[C@H](OC(=O)c2ccc4ccc5cccc6ccc2c4c56)[C@H]1O3.ClC(Cl)Cl |
| InChI | InChI=1S/C47H40O8Si.CHCl3/c1-47(2,3)56(4,5)55-43-41-38(50-44(48)32-22-18-28-14-12-24-8-6-10-26-16-20-30(32)36(28)34(24)26)40-39(42(43)54-46(52-40)53-41)51-45(49)33-23-19-29-15-13-25-9-7-11-27-17-21-31(33)37(29)35(25)27;2-1(3)4/h6-23,38-43,46H,1-5H3;1H/t38-,39+,40?,41+,42-,43?,46?; |
| InChIKey | WTQRWOWJXBWGQD-ZAPDOSCISA-N |
| XLogP | 12.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.29 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|