C57H66O8Si — CID 10865877
[(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxo-8-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]octanoate (PubChem CID 10865877) has the molecular formula C57H66O8Si and a molecular weight of 907.23 g/mol. Its IUPAC name is [(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxo-8-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]octanoate.
| Compound Name | [(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxo-8-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]octanoate |
|---|---|
| PubChem CID | 10865877 |
| Molecular Formula | C57H66O8Si |
| Molecular Weight | 907.23 g/mol |
| Exact Mass | 906.45 |
| IUPAC Name | [(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxo-8-[(2R,4S,6R)-2-phenyl-6-(trityloxymethyl)-1,3-dioxan-4-yl]octanoate |
| SMILES | CO[C@H](CC(=O)C[C@@H]1C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H](c2ccccc2)O1)C[C@@H](CC(=O)O[C@@H](C)c1ccc2ccccc2c1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C57H66O8Si/c1-41(44-33-32-42-22-20-21-25-45(42)34-44)62-54(59)39-52(65-66(6,7)56(2,3)4)37-50(60-5)35-49(58)36-51-38-53(64-55(63-51)43-23-12-8-13-24-43)40-61-57(46-26-14-9-15-27-46,47-28-16-10-17-29-47)48-30-18-11-19-31-48/h8-34,41,50-53,55H,35-40H2,1-7H3/t41-,50+,51+,52-,53+,55+/m0/s1 |
| InChIKey | FOIGPIJITYUQFR-LVYHXWMYSA-N |
| XLogP | 12.86 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.23 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|