C38H46O5Si — CID 134865704
(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-naphthalen-1-yl(oxan-2-yloxy)methyl]hexanoic acid (PubChem CID 134865704) has the molecular formula C38H46O5Si and a molecular weight of 610.87 g/mol. Its IUPAC name is (2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-naphthalen-1-yl(oxan-2-yloxy)methyl]hexanoic acid.
| Compound Name | (2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-naphthalen-1-yl(oxan-2-yloxy)methyl]hexanoic acid |
|---|---|
| PubChem CID | 134865704 |
| Molecular Formula | C38H46O5Si |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | (2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-naphthalen-1-yl(oxan-2-yloxy)methyl]hexanoic acid |
| SMILES | CC(C)(C)[Si](OCCCC[C@H](C(=O)O)[C@H](OC1CCCCO1)c1cccc2ccccc12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H46O5Si/c1-38(2,3)44(30-19-6-4-7-20-30,31-21-8-5-9-22-31)42-28-15-12-24-34(37(39)40)36(43-35-26-13-14-27-41-35)33-25-16-18-29-17-10-11-23-32(29)33/h4-11,16-23,25,34-36H,12-15,24,26-28H2,1-3H3,(H,39,40)/t34-,35?,36+/m0/s1 |
| InChIKey | VCJMEVIMSLCNAH-LOZVQPLVSA-N |
| XLogP | 7.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|