C40H56O8Si — CID 134878829
[(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,4S,6R)-6-(ethoxymethyl)-2-phenyl-1,3-dioxan-4-yl]-5-methoxy-7-oxooctanoate (PubChem CID 134878829) has the molecular formula C40H56O8Si and a molecular weight of 692.97 g/mol. Its IUPAC name is [(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,4S,6R)-6-(ethoxymethyl)-2-phenyl-1,3-dioxan-4-yl]-5-methoxy-7-oxooctanoate.
| Compound Name | [(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,4S,6R)-6-(ethoxymethyl)-2-phenyl-1,3-dioxan-4-yl]-5-methoxy-7-oxooctanoate |
|---|---|
| PubChem CID | 134878829 |
| Molecular Formula | C40H56O8Si |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.37 |
| IUPAC Name | [(1S)-1-naphthalen-2-ylethyl] (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-8-[(2R,4S,6R)-6-(ethoxymethyl)-2-phenyl-1,3-dioxan-4-yl]-5-methoxy-7-oxooctanoate |
| SMILES | CCOC[C@H]1C[C@@H](CC(=O)C[C@H](C[C@@H](CC(=O)O[C@@H](C)c2ccc3ccccc3c2)O[Si](C)(C)C(C)(C)C)OC)O[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C40H56O8Si/c1-9-44-27-37-25-35(46-39(47-37)30-16-11-10-12-17-30)23-33(41)22-34(43-6)24-36(48-49(7,8)40(3,4)5)26-38(42)45-28(2)31-20-19-29-15-13-14-18-32(29)21-31/h10-21,28,34-37,39H,9,22-27H2,1-8H3/t28-,34+,35+,36-,37+,39+/m0/s1 |
| InChIKey | UIKAUZJEYLTTTI-FVRZGJTASA-N |
| XLogP | 8.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|