C33H29NO4 — CID 139181675
ethyl (3R,4S,5S)-5-acetyl-1'-(anthracen-9-ylmethyl)-3-methyl-2'-oxospiro[cyclopentene-4,3'-indole]-1-carboxylate (PubChem CID 139181675) has the molecular formula C33H29NO4 and a molecular weight of 503.60 g/mol. Its IUPAC name is ethyl (3R,4S,5S)-5-acetyl-1'-(anthracen-9-ylmethyl)-3-methyl-2'-oxospiro[cyclopentene-4,3'-indole]-1-carboxylate.
| Compound Name | ethyl (3R,4S,5S)-5-acetyl-1'-(anthracen-9-ylmethyl)-3-methyl-2'-oxospiro[cyclopentene-4,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 139181675 |
| Molecular Formula | C33H29NO4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | ethyl (3R,4S,5S)-5-acetyl-1'-(anthracen-9-ylmethyl)-3-methyl-2'-oxospiro[cyclopentene-4,3'-indole]-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](C)[C@]2(C(=O)N(Cc3c4ccccc4cc4ccccc34)c3ccccc32)[C@@H]1C(C)=O |
| InChI | InChI=1S/C33H29NO4/c1-4-38-31(36)26-17-20(2)33(30(26)21(3)35)28-15-9-10-16-29(28)34(32(33)37)19-27-24-13-7-5-11-22(24)18-23-12-6-8-14-25(23)27/h5-18,20,30H,4,19H2,1-3H3/t20-,30-,33-/m1/s1 |
| InChIKey | NNJKILZFXXDGCR-JSSHLTTDSA-N |
| XLogP | 6.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|