C34H34BO2P — CID 139184653
[bis(2-hydroxy-2,2-diphenylethyl)-phenylphosphaniumyl]boranuide (PubChem CID 139184653) has the molecular formula C34H34BO2P and a molecular weight of 516.43 g/mol. Its IUPAC name is [bis(2-hydroxy-2,2-diphenylethyl)-phenylphosphaniumyl]boranuide.
| Compound Name | [bis(2-hydroxy-2,2-diphenylethyl)-phenylphosphaniumyl]boranuide |
|---|---|
| PubChem CID | 139184653 |
| Molecular Formula | C34H34BO2P |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [bis(2-hydroxy-2,2-diphenylethyl)-phenylphosphaniumyl]boranuide |
| SMILES | [BH3-][P+](CC(O)(c1ccccc1)c1ccccc1)(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34BO2P/c35-38(32-24-14-5-15-25-32,26-33(36,28-16-6-1-7-17-28)29-18-8-2-9-19-29)27-34(37,30-20-10-3-11-21-30)31-22-12-4-13-23-31/h1-25,36-37H,26-27H2,35H3 |
| InChIKey | XVQGGBBSWMUDNP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|