About 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine
1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine (PubChem CID 139186104) has the molecular formula C19H19F3N2
and a molecular weight of 332.37 g/mol. Its IUPAC name is 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine.
Molecular Properties
| Compound Name | 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine |
| PubChem CID | 139186104 |
| Molecular Formula | C19H19F3N2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine |
| SMILES | FC(F)(F)/C(=C/c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19F3N2/c20-19(21,22)18(15-16-7-3-1-4-8-16)24-13-11-23(12-14-24)17-9-5-2-6-10-17/h1-10,15H,11-14H2/b18-15- |
| InChIKey | UZBYOSNXLCAUQK-SDXDJHTJSA-N |
| XLogP | 4.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine?
The IUPAC name of 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine (CID 139186104) is 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine.
What is the SMILES notation for 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine?
The canonical SMILES for 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine is FC(F)(F)/C(=C/c1ccccc1)N1CCN(c2ccccc2)CC1.
What is the InChIKey of 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine?
The InChIKey is UZBYOSNXLCAUQK-SDXDJHTJSA-N. The full InChI is InChI=1S/C19H19F3N2/c20-19(21,22)18(15-16-7-3-1-4-8-16)24-13-11-23(12-14-24)17-9-5-2-6-10-17/h1-10,15H,11-14H2/b18-15-.
What are the key properties of 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine?
1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine has a molecular weight of 332.37 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4-[(Z)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperazine is sourced from PubChem (CID 139186104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).