C15H15F7N2OS — CID 21206558
2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 21206558) has the molecular formula C15H15F7N2OS and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 21206558 |
| Molecular Formula | C15H15F7N2OS |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(CSC(F)(F)C(F)(F)C(F)(F)F)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H15F7N2OS/c16-13(17,14(18,19)20)15(21,22)26-10-12(25)24-8-6-23(7-9-24)11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | ICMBYVDIBKBYDT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|